C34H52Cl3N3O5S — CID 69469534
N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]methanesulfonamide;(1S)-1-(2,3-dichlorophenyl)-5-ethoxy-1-piperidin-3-ylpentan-1-ol (PubChem CID 69469534) has the molecular formula C34H52Cl3N3O5S and a molecular weight of 721.23 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]methanesulfonamide;(1S)-1-(2,3-dichlorophenyl)-5-ethoxy-1-piperidin-3-ylpentan-1-ol.
| Compound Name | N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]methanesulfonamide;(1S)-1-(2,3-dichlorophenyl)-5-ethoxy-1-piperidin-3-ylpentan-1-ol |
|---|---|
| PubChem CID | 69469534 |
| Molecular Formula | C34H52Cl3N3O5S |
| Molecular Weight | 721.23 g/mol |
| Exact Mass | 719.27 |
| IUPAC Name | N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]methanesulfonamide;(1S)-1-(2,3-dichlorophenyl)-5-ethoxy-1-piperidin-3-ylpentan-1-ol |
| SMILES | CCOCCCC[C@@](O)(c1cccc(Cl)c1Cl)C1CCCNC1.CS(=O)(=O)NCCCC(O)(c1cccc(Cl)c1)C1CCCNC1 |
| InChI | InChI=1S/C18H27Cl2NO2.C16H25ClN2O3S/c1-2-23-12-4-3-10-18(22,14-7-6-11-21-13-14)15-8-5-9-16(19)17(15)20;1-23(21,22)19-10-4-8-16(20,14-6-3-9-18-12-14)13-5-2-7-15(17)11-13/h5,8-9,14,21-22H,2-4,6-7,10-13H2,1H3;2,5,7,11,14,18-20H,3-4,6,8-10,12H2,1H3/t14?,18-;/m0./s1 |
| InChIKey | COFSVJJAYKWZDU-XYGCWZSBSA-N |
| XLogP | 6.24 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.23 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|