C23H36ClNO6S — CID 59201550
tert-butyl (3R)-3-[(1R)-1-(3-chlorophenyl)-1-(2-methylsulfonyloxyethoxy)butyl]piperidine-1-carboxylate (PubChem CID 59201550) has the molecular formula C23H36ClNO6S and a molecular weight of 490.06 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1R)-1-(3-chlorophenyl)-1-(2-methylsulfonyloxyethoxy)butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1R)-1-(3-chlorophenyl)-1-(2-methylsulfonyloxyethoxy)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59201550 |
| Molecular Formula | C23H36ClNO6S |
| Molecular Weight | 490.06 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | tert-butyl (3R)-3-[(1R)-1-(3-chlorophenyl)-1-(2-methylsulfonyloxyethoxy)butyl]piperidine-1-carboxylate |
| SMILES | CCC[C@](OCCOS(C)(=O)=O)(c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H36ClNO6S/c1-6-12-23(18-9-7-11-20(24)16-18,29-14-15-30-32(5,27)28)19-10-8-13-25(17-19)21(26)31-22(2,3)4/h7,9,11,16,19H,6,8,10,12-15,17H2,1-5H3/t19-,23+/m1/s1 |
| InChIKey | WKBZEEILDFKIJW-XXBNENTESA-N |
| XLogP | 4.98 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.06 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|