C20H31ClN2O5S — CID 59419828
tert-butyl 3-[3-chloro-N-(3-methylsulfonyloxypropyl)anilino]piperidine-1-carboxylate (PubChem CID 59419828) has the molecular formula C20H31ClN2O5S and a molecular weight of 447.00 g/mol. Its IUPAC name is tert-butyl 3-[3-chloro-N-(3-methylsulfonyloxypropyl)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-chloro-N-(3-methylsulfonyloxypropyl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59419828 |
| Molecular Formula | C20H31ClN2O5S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | tert-butyl 3-[3-chloro-N-(3-methylsulfonyloxypropyl)anilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N(CCCOS(C)(=O)=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H31ClN2O5S/c1-20(2,3)28-19(24)22-11-6-10-18(15-22)23(12-7-13-27-29(4,25)26)17-9-5-8-16(21)14-17/h5,8-9,14,18H,6-7,10-13,15H2,1-4H3 |
| InChIKey | RYCHIKZKTXWGOH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|