C15H19ClN2O2 — CID 69175008
3-(3-chloro-N-prop-2-enylanilino)piperidine-1-carboxylic acid (PubChem CID 69175008) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 3-(3-chloro-N-prop-2-enylanilino)piperidine-1-carboxylic acid.
| Compound Name | 3-(3-chloro-N-prop-2-enylanilino)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69175008 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-(3-chloro-N-prop-2-enylanilino)piperidine-1-carboxylic acid |
| SMILES | C=CCN(c1cccc(Cl)c1)C1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-2-8-18(13-6-3-5-12(16)10-13)14-7-4-9-17(11-14)15(19)20/h2-3,5-6,10,14H,1,4,7-9,11H2,(H,19,20) |
| InChIKey | LMJUVFJSWLMUAY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|