C19H19ClN2O3 — CID 118597247
(3R)-3-[chloro-[(1R)-1-naphthalen-1-yl-3-oxoprop-2-enyl]amino]piperidine-1-carboxylic acid (PubChem CID 118597247) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is (3R)-3-[chloro-[(1R)-1-naphthalen-1-yl-3-oxoprop-2-enyl]amino]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[chloro-[(1R)-1-naphthalen-1-yl-3-oxoprop-2-enyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118597247 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (3R)-3-[chloro-[(1R)-1-naphthalen-1-yl-3-oxoprop-2-enyl]amino]piperidine-1-carboxylic acid |
| SMILES | O=C=C[C@H](c1cccc2ccccc12)N(Cl)[C@@H]1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C19H19ClN2O3/c20-22(15-7-4-11-21(13-15)19(24)25)18(10-12-23)17-9-3-6-14-5-1-2-8-16(14)17/h1-3,5-6,8-10,15,18H,4,7,11,13H2,(H,24,25)/t15-,18-/m1/s1 |
| InChIKey | OLLWHENNEHUFOI-CRAIPNDOSA-N |
| XLogP | 3.87 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|