C25H28N2O2 — CID 67409796
2-benzyl-3-[[(1R)-1-naphthalen-1-ylethyl]amino]piperidine-1-carboxylic acid (PubChem CID 67409796) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-benzyl-3-[[(1R)-1-naphthalen-1-ylethyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 2-benzyl-3-[[(1R)-1-naphthalen-1-ylethyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67409796 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-benzyl-3-[[(1R)-1-naphthalen-1-ylethyl]amino]piperidine-1-carboxylic acid |
| SMILES | C[C@@H](NC1CCCN(C(=O)O)C1Cc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H28N2O2/c1-18(21-14-7-12-20-11-5-6-13-22(20)21)26-23-15-8-16-27(25(28)29)24(23)17-19-9-3-2-4-10-19/h2-7,9-14,18,23-24,26H,8,15-17H2,1H3,(H,28,29)/t18-,23?,24?/m1/s1 |
| InChIKey | AMNXSNLWDNNQGF-WZFBRQLOSA-N |
| XLogP | 5.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |