C20H26N2O — CID 51730374
2-[(3S)-3-methylpiperidin-1-yl]-N-[(1R)-1-naphthalen-1-ylethyl]acetamide (PubChem CID 51730374) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-[(3S)-3-methylpiperidin-1-yl]-N-[(1R)-1-naphthalen-1-ylethyl]acetamide.
| Compound Name | 2-[(3S)-3-methylpiperidin-1-yl]-N-[(1R)-1-naphthalen-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 51730374 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-[(3S)-3-methylpiperidin-1-yl]-N-[(1R)-1-naphthalen-1-ylethyl]acetamide |
| SMILES | C[C@H]1CCCN(CC(=O)N[C@H](C)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C20H26N2O/c1-15-7-6-12-22(13-15)14-20(23)21-16(2)18-11-5-9-17-8-3-4-10-19(17)18/h3-5,8-11,15-16H,6-7,12-14H2,1-2H3,(H,21,23)/t15-,16+/m0/s1 |
| InChIKey | PMKGCAPOHFZFLU-JKSUJKDBSA-N |
| XLogP | 3.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |