C20H32N2O — CID 2682066
N-[2,6-di(propan-2-yl)phenyl]-2-[(3R)-3-methylpiperidin-1-yl]acetamide (PubChem CID 2682066) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[(3R)-3-methylpiperidin-1-yl]acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(3R)-3-methylpiperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2682066 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(3R)-3-methylpiperidin-1-yl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CN1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C20H32N2O/c1-14(2)17-9-6-10-18(15(3)4)20(17)21-19(23)13-22-11-7-8-16(5)12-22/h6,9-10,14-16H,7-8,11-13H2,1-5H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | FGTSFLFLSXRGNF-MRXNPFEDSA-N |
| XLogP | 4.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |