C17H23ClN2O4 — CID 68713391
(3R)-3-[[2-(3-chloro-N-ethylanilino)-2-oxoethoxy]methyl]piperidine-1-carboxylic acid (PubChem CID 68713391) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is (3R)-3-[[2-(3-chloro-N-ethylanilino)-2-oxoethoxy]methyl]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[[2-(3-chloro-N-ethylanilino)-2-oxoethoxy]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68713391 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (3R)-3-[[2-(3-chloro-N-ethylanilino)-2-oxoethoxy]methyl]piperidine-1-carboxylic acid |
| SMILES | CCN(C(=O)COC[C@@H]1CCCN(C(=O)O)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-2-20(15-7-3-6-14(18)9-15)16(21)12-24-11-13-5-4-8-19(10-13)17(22)23/h3,6-7,9,13H,2,4-5,8,10-12H2,1H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | FAAOJUUTOVYLKL-CYBMUJFWSA-N |
| XLogP | 3.10 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |