C19H26ClNO2 — CID 110617224
2-(4-chlorophenyl)-2-cyclopropyl-1-[3-(ethoxymethyl)piperidin-1-yl]ethanone (PubChem CID 110617224) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-cyclopropyl-1-[3-(ethoxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-2-cyclopropyl-1-[3-(ethoxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110617224 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-(4-chlorophenyl)-2-cyclopropyl-1-[3-(ethoxymethyl)piperidin-1-yl]ethanone |
| SMILES | CCOCC1CCCN(C(=O)C(c2ccc(Cl)cc2)C2CC2)C1 |
| InChI | InChI=1S/C19H26ClNO2/c1-2-23-13-14-4-3-11-21(12-14)19(22)18(15-5-6-15)16-7-9-17(20)10-8-16/h7-10,14-15,18H,2-6,11-13H2,1H3 |
| InChIKey | VJEQRMGBVFMOEP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |