C21H31NO2 — CID 110633226
2-cyclohexyl-1-[3-(hydroxymethyl)piperidin-1-yl]-2-(4-methylphenyl)ethanone (PubChem CID 110633226) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 2-cyclohexyl-1-[3-(hydroxymethyl)piperidin-1-yl]-2-(4-methylphenyl)ethanone.
| Compound Name | 2-cyclohexyl-1-[3-(hydroxymethyl)piperidin-1-yl]-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 110633226 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-cyclohexyl-1-[3-(hydroxymethyl)piperidin-1-yl]-2-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(C(=O)N2CCCC(CO)C2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H31NO2/c1-16-9-11-19(12-10-16)20(18-7-3-2-4-8-18)21(24)22-13-5-6-17(14-22)15-23/h9-12,17-18,20,23H,2-8,13-15H2,1H3 |
| InChIKey | JMAPYAUOOGQVKJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |