C14H21BrN2OSi — CID 154639223
(5-bromo-1H-pyrrolo[3,2-b]pyridin-2-yl)methoxy-tert-butyl-dimethylsilane (PubChem CID 154639223) has the molecular formula C14H21BrN2OSi and a molecular weight of 341.33 g/mol. Its IUPAC name is (5-bromo-1H-pyrrolo[3,2-b]pyridin-2-yl)methoxy-tert-butyl-dimethylsilane.
| Compound Name | (5-bromo-1H-pyrrolo[3,2-b]pyridin-2-yl)methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 154639223 |
| Molecular Formula | C14H21BrN2OSi |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (5-bromo-1H-pyrrolo[3,2-b]pyridin-2-yl)methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc2nc(Br)ccc2[nH]1 |
| InChI | InChI=1S/C14H21BrN2OSi/c1-14(2,3)19(4,5)18-9-10-8-12-11(16-10)6-7-13(15)17-12/h6-8,16H,9H2,1-5H3 |
| InChIKey | NKNOOLWKJOJKPF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|