C12H23NOSSi — CID 91214846
[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-pyrrol-2-yl]methanethiol (PubChem CID 91214846) has the molecular formula C12H23NOSSi and a molecular weight of 257.47 g/mol. Its IUPAC name is [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-pyrrol-2-yl]methanethiol.
| Compound Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-pyrrol-2-yl]methanethiol |
|---|---|
| PubChem CID | 91214846 |
| Molecular Formula | C12H23NOSSi |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-pyrrol-2-yl]methanethiol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(CS)[nH]1 |
| InChI | InChI=1S/C12H23NOSSi/c1-12(2,3)16(4,5)14-8-10-6-7-11(9-15)13-10/h6-7,13,15H,8-9H2,1-5H3 |
| InChIKey | MRSCVZWRGWDYMS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|