C13H23NO3Si — CID 140824907
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-1H-pyridin-4-one (PubChem CID 140824907) has the molecular formula C13H23NO3Si and a molecular weight of 269.42 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-1H-pyridin-4-one.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-1H-pyridin-4-one |
|---|---|
| PubChem CID | 140824907 |
| Molecular Formula | C13H23NO3Si |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-1H-pyridin-4-one |
| SMILES | COc1c[nH]c(CO[Si](C)(C)C(C)(C)C)cc1=O |
| InChI | InChI=1S/C13H23NO3Si/c1-13(2,3)18(5,6)17-9-10-7-11(15)12(16-4)8-14-10/h7-8H,9H2,1-6H3,(H,14,15) |
| InChIKey | GJTXPXMJSLRKQW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|