C14H22F3NO5SSi — CID 140824920
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 140824920) has the molecular formula C14H22F3NO5SSi and a molecular weight of 401.48 g/mol. Its IUPAC name is [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140824920 |
| Molecular Formula | C14H22F3NO5SSi |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | COc1cnc(CO[Si](C)(C)C(C)(C)C)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H22F3NO5SSi/c1-13(2,3)25(5,6)22-9-10-7-11(12(21-4)8-18-10)23-24(19,20)14(15,16)17/h7-8H,9H2,1-6H3 |
| InChIKey | JPQRMBJMUMGPQO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|