C13H21F3O6S2Si — CID 174845755
(4,5-dimethyl-2-trimethylsilylphenyl) trifluoromethanesulfonate;methanesulfonic acid (PubChem CID 174845755) has the molecular formula C13H21F3O6S2Si and a molecular weight of 422.52 g/mol. Its IUPAC name is (4,5-dimethyl-2-trimethylsilylphenyl) trifluoromethanesulfonate;methanesulfonic acid.
| Compound Name | (4,5-dimethyl-2-trimethylsilylphenyl) trifluoromethanesulfonate;methanesulfonic acid |
|---|---|
| PubChem CID | 174845755 |
| Molecular Formula | C13H21F3O6S2Si |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | (4,5-dimethyl-2-trimethylsilylphenyl) trifluoromethanesulfonate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1cc(OS(=O)(=O)C(F)(F)F)c([Si](C)(C)C)cc1C |
| InChI | InChI=1S/C12H17F3O3SSi.CH4O3S/c1-8-6-10(18-19(16,17)12(13,14)15)11(7-9(8)2)20(3,4)5;1-5(2,3)4/h6-7H,1-5H3;1H3,(H,2,3,4) |
| InChIKey | IJGIFZRXTPJEBW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|