C19H25F3IO3SSi2+ — CID 177401315
phenyl-[4-(trifluoromethylsulfonyloxy)-2,5-bis(trimethylsilyl)phenyl]iodanium (PubChem CID 177401315) has the molecular formula C19H25F3IO3SSi2+ and a molecular weight of 573.54 g/mol. Its IUPAC name is phenyl-[4-(trifluoromethylsulfonyloxy)-2,5-bis(trimethylsilyl)phenyl]iodanium.
| Compound Name | phenyl-[4-(trifluoromethylsulfonyloxy)-2,5-bis(trimethylsilyl)phenyl]iodanium |
|---|---|
| PubChem CID | 177401315 |
| Molecular Formula | C19H25F3IO3SSi2+ |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.01 |
| IUPAC Name | phenyl-[4-(trifluoromethylsulfonyloxy)-2,5-bis(trimethylsilyl)phenyl]iodanium |
| SMILES | C[Si](C)(C)c1cc([I+]c2ccccc2)c([Si](C)(C)C)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H25F3IO3SSi2/c1-28(2,3)17-13-16(26-27(24,25)19(20,21)22)18(29(4,5)6)12-15(17)23-14-10-8-7-9-11-14/h7-13H,1-6H3/q+1 |
| InChIKey | LOEXNGHQRAFBIG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|