About cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate
cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate (PubChem CID 174845505) has the molecular formula C10H14CsF3O3SSi
and a molecular weight of 432.27 g/mol. Its IUPAC name is cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate |
| PubChem CID | 174845505 |
| Molecular Formula | C10H14CsF3O3SSi |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.94 |
| IUPAC Name | cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1ccccc1OS(=O)(=O)C(F)(F)F.[Cs+].[H-] |
| InChI | InChI=1S/C10H13F3O3SSi.Cs.H/c1-18(2,3)9-7-5-4-6-8(9)16-17(14,15)10(11,12)13;;/h4-7H,1-3H3;;/q;+1;-1 |
| InChIKey | PWMWEHWTSDCOKT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate?
The IUPAC name of cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate (CID 174845505) is cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate.
What is the SMILES notation for cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate?
The canonical SMILES for cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate is C[Si](C)(C)c1ccccc1OS(=O)(=O)C(F)(F)F.[Cs+].[H-].
What is the InChIKey of cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate?
The InChIKey is PWMWEHWTSDCOKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3O3SSi.Cs.H/c1-18(2,3)9-7-5-4-6-8(9)16-17(14,15)10(11,12)13;;/h4-7H,1-3H3;;/q;+1;-1.
What are the key properties of cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate?
cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate has a molecular weight of 432.27 g/mol, XLogP of -0.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;hydride;(2-trimethylsilylphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 174845505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).