C10H11F3O3SSi — CID 122376066
(6-trimethylsilylcyclohexa-1,5-dien-3-yn-1-yl) trifluoromethanesulfonate (PubChem CID 122376066) has the molecular formula C10H11F3O3SSi and a molecular weight of 296.34 g/mol. Its IUPAC name is (6-trimethylsilylcyclohexa-1,5-dien-3-yn-1-yl) trifluoromethanesulfonate.
| Compound Name | (6-trimethylsilylcyclohexa-1,5-dien-3-yn-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122376066 |
| Molecular Formula | C10H11F3O3SSi |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (6-trimethylsilylcyclohexa-1,5-dien-3-yn-1-yl) trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1cc#ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3O3SSi/c1-18(2,3)9-7-5-4-6-8(9)16-17(14,15)10(11,12)13/h6-7H,1-3H3 |
| InChIKey | FGIHUNTULSDILH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|