C10H13BBrF3O5SSi — CID 135029430
[3-bromo-4-(trifluoromethylsulfonyloxy)-5-trimethylsilylphenyl]boronic acid (PubChem CID 135029430) has the molecular formula C10H13BBrF3O5SSi and a molecular weight of 421.07 g/mol. Its IUPAC name is [3-bromo-4-(trifluoromethylsulfonyloxy)-5-trimethylsilylphenyl]boronic acid.
| Compound Name | [3-bromo-4-(trifluoromethylsulfonyloxy)-5-trimethylsilylphenyl]boronic acid |
|---|---|
| PubChem CID | 135029430 |
| Molecular Formula | C10H13BBrF3O5SSi |
| Molecular Weight | 421.07 g/mol |
| Exact Mass | 419.95 |
| IUPAC Name | [3-bromo-4-(trifluoromethylsulfonyloxy)-5-trimethylsilylphenyl]boronic acid |
| SMILES | C[Si](C)(C)c1cc(B(O)O)cc(Br)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13BBrF3O5SSi/c1-22(2,3)8-5-6(11(16)17)4-7(12)9(8)20-21(18,19)10(13,14)15/h4-5,16-17H,1-3H3 |
| InChIKey | UMJXQGUEKDZIOW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.07 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|