C22H28F3NO3SSi — CID 159606344
3-tert-butyl-1H-isoindole;(2-trimethylsilylphenyl) trifluoromethanesulfonate (PubChem CID 159606344) has the molecular formula C22H28F3NO3SSi and a molecular weight of 471.62 g/mol. Its IUPAC name is 3-tert-butyl-1H-isoindole;(2-trimethylsilylphenyl) trifluoromethanesulfonate.
| Compound Name | 3-tert-butyl-1H-isoindole;(2-trimethylsilylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159606344 |
| Molecular Formula | C22H28F3NO3SSi |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-tert-butyl-1H-isoindole;(2-trimethylsilylphenyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)C1=NCc2ccccc21.C[Si](C)(C)c1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15N.C10H13F3O3SSi/c1-12(2,3)11-10-7-5-4-6-9(10)8-13-11;1-18(2,3)9-7-5-4-6-8(9)16-17(14,15)10(11,12)13/h4-7H,8H2,1-3H3;4-7H,1-3H3 |
| InChIKey | MMCYNMSPIKIQFQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|