C10H10F3IO5S2 — CID 146619372
(2-iodosulfanyl-3,4-dimethoxy-5-methylphenyl) trifluoromethanesulfonate (PubChem CID 146619372) has the molecular formula C10H10F3IO5S2 and a molecular weight of 458.22 g/mol. Its IUPAC name is (2-iodosulfanyl-3,4-dimethoxy-5-methylphenyl) trifluoromethanesulfonate.
| Compound Name | (2-iodosulfanyl-3,4-dimethoxy-5-methylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146619372 |
| Molecular Formula | C10H10F3IO5S2 |
| Molecular Weight | 458.22 g/mol |
| Exact Mass | 457.90 |
| IUPAC Name | (2-iodosulfanyl-3,4-dimethoxy-5-methylphenyl) trifluoromethanesulfonate |
| SMILES | COc1c(C)cc(OS(=O)(=O)C(F)(F)F)c(SI)c1OC |
| InChI | InChI=1S/C10H10F3IO5S2/c1-5-4-6(19-21(15,16)10(11,12)13)9(20-14)8(18-3)7(5)17-2/h4H,1-3H3 |
| InChIKey | QXWNKNCVSFYFEQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|