C20H24F3IO5SSi — CID 11858935
[3-[tert-butyl(dimethyl)silyl]oxy-2-iodo-5-phenylmethoxyphenyl] trifluoromethanesulfonate (PubChem CID 11858935) has the molecular formula C20H24F3IO5SSi and a molecular weight of 588.46 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-2-iodo-5-phenylmethoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-iodo-5-phenylmethoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11858935 |
| Molecular Formula | C20H24F3IO5SSi |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 588.01 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-iodo-5-phenylmethoxyphenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(OCc2ccccc2)cc(OS(=O)(=O)C(F)(F)F)c1I |
| InChI | InChI=1S/C20H24F3IO5SSi/c1-19(2,3)31(4,5)29-17-12-15(27-13-14-9-7-6-8-10-14)11-16(18(17)24)28-30(25,26)20(21,22)23/h6-12H,13H2,1-5H3 |
| InChIKey | LGNKVKYKCUGQMZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|