C22H30O5Si — CID 153336312
2-[2-[tert-butyl(dimethyl)silyl]oxyoxiran-2-yl]-3-methoxy-5-phenylmethoxyphenol (PubChem CID 153336312) has the molecular formula C22H30O5Si and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyoxiran-2-yl]-3-methoxy-5-phenylmethoxyphenol.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyoxiran-2-yl]-3-methoxy-5-phenylmethoxyphenol |
|---|---|
| PubChem CID | 153336312 |
| Molecular Formula | C22H30O5Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyoxiran-2-yl]-3-methoxy-5-phenylmethoxyphenol |
| SMILES | COc1cc(OCc2ccccc2)cc(O)c1C1(O[Si](C)(C)C(C)(C)C)CO1 |
| InChI | InChI=1S/C22H30O5Si/c1-21(2,3)28(5,6)27-22(15-26-22)20-18(23)12-17(13-19(20)24-4)25-14-16-10-8-7-9-11-16/h7-13,23H,14-15H2,1-6H3 |
| InChIKey | BFQPGEBNAQOASD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|