C20H27BrO3Si — CID 59089862
(5-bromo-4-methoxy-2-phenylmethoxyphenoxy)-tert-butyl-dimethylsilane (PubChem CID 59089862) has the molecular formula C20H27BrO3Si and a molecular weight of 423.42 g/mol. Its IUPAC name is (5-bromo-4-methoxy-2-phenylmethoxyphenoxy)-tert-butyl-dimethylsilane.
| Compound Name | (5-bromo-4-methoxy-2-phenylmethoxyphenoxy)-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 59089862 |
| Molecular Formula | C20H27BrO3Si |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (5-bromo-4-methoxy-2-phenylmethoxyphenoxy)-tert-butyl-dimethylsilane |
| SMILES | COc1cc(OCc2ccccc2)c(O[Si](C)(C)C(C)(C)C)cc1Br |
| InChI | InChI=1S/C20H27BrO3Si/c1-20(2,3)25(5,6)24-19-12-16(21)17(22-4)13-18(19)23-14-15-10-8-7-9-11-15/h7-13H,14H2,1-6H3 |
| InChIKey | BBQBSMXPGIVXPS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|