C42H46O6Si — CID 102452219
(2R,3R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyphenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-ol (PubChem CID 102452219) has the molecular formula C42H46O6Si and a molecular weight of 674.91 g/mol. Its IUPAC name is (2R,3R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyphenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | (2R,3R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyphenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 102452219 |
| Molecular Formula | C42H46O6Si |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | (2R,3R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyphenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc([C@H]2Oc3cc(OCc4ccccc4)cc(OCc4ccccc4)c3C[C@H]2O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C42H46O6Si/c1-42(2,3)49(4,5)48-37-22-21-33(23-40(37)46-29-32-19-13-8-14-20-32)41-36(43)26-35-38(45-28-31-17-11-7-12-18-31)24-34(25-39(35)47-41)44-27-30-15-9-6-10-16-30/h6-25,36,41,43H,26-29H2,1-5H3/t36-,41-/m1/s1 |
| InChIKey | XKGREERRNDJLGC-PDGFCRNHSA-N |
| XLogP | 9.84 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|