C50H44O6 — CID 11331634
(2R,3S)-2-[3,4-bis(phenylmethoxy)phenyl]-3,5,7-tris(phenylmethoxy)-3,4-dihydro-2H-chromene (PubChem CID 11331634) has the molecular formula C50H44O6 and a molecular weight of 740.90 g/mol. Its IUPAC name is (2R,3S)-2-[3,4-bis(phenylmethoxy)phenyl]-3,5,7-tris(phenylmethoxy)-3,4-dihydro-2H-chromene.
| Compound Name | (2R,3S)-2-[3,4-bis(phenylmethoxy)phenyl]-3,5,7-tris(phenylmethoxy)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 11331634 |
| Molecular Formula | C50H44O6 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.31 |
| IUPAC Name | (2R,3S)-2-[3,4-bis(phenylmethoxy)phenyl]-3,5,7-tris(phenylmethoxy)-3,4-dihydro-2H-chromene |
| SMILES | c1ccc(COc2cc(OCc3ccccc3)c3c(c2)O[C@H](c2ccc(OCc4ccccc4)c(OCc4ccccc4)c2)[C@@H](OCc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C50H44O6/c1-6-16-37(17-7-1)32-51-43-29-46(53-34-39-20-10-3-11-21-39)44-31-49(55-36-41-24-14-5-15-25-41)50(56-47(44)30-43)42-26-27-45(52-33-38-18-8-2-9-19-38)48(28-42)54-35-40-22-12-4-13-23-40/h1-30,49-50H,31-36H2/t49-,50+/m0/s1 |
| InChIKey | ZQXZWSRJQYKNEG-LOYCUKJKSA-N |
| XLogP | 11.26 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.90 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |