C71H60O10 — CID 87678495
[(2R,3S)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] 3,5-bis(phenylmethoxy)benzoate (PubChem CID 87678495) has the molecular formula C71H60O10 and a molecular weight of 1073.25 g/mol. Its IUPAC name is [(2R,3S)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] 3,5-bis(phenylmethoxy)benzoate.
| Compound Name | [(2R,3S)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] 3,5-bis(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 87678495 |
| Molecular Formula | C71H60O10 |
| Molecular Weight | 1073.25 g/mol |
| Exact Mass | 1072.42 |
| IUPAC Name | [(2R,3S)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] 3,5-bis(phenylmethoxy)benzoate |
| SMILES | O=C(O[C@H]1Cc2c(OCc3ccccc3)cc(OCc3ccccc3)cc2O[C@@H]1c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C71H60O10/c72-71(59-36-60(73-44-51-22-8-1-9-23-51)40-61(37-59)74-45-52-24-10-2-11-25-52)81-68-43-63-64(76-47-54-28-14-4-15-29-54)41-62(75-46-53-26-12-3-13-27-53)42-65(63)80-69(68)58-38-66(77-48-55-30-16-5-17-31-55)70(79-50-57-34-20-7-21-35-57)67(39-58)78-49-56-32-18-6-19-33-56/h1-42,68-69H,43-50H2/t68-,69+/m0/s1 |
| InChIKey | LSELVJVNZUJKDC-JPFIOEMMSA-N |
| XLogP | 15.64 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.25 |
| LogP ≤ 5 | 15.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |