C57H54O9 — CID 166479692
[(2S,3R)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] 4-hydroxycyclohexane-1-carboxylate (PubChem CID 166479692) has the molecular formula C57H54O9 and a molecular weight of 883.05 g/mol. Its IUPAC name is [(2S,3R)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] 4-hydroxycyclohexane-1-carboxylate.
| Compound Name | [(2S,3R)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] 4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 166479692 |
| Molecular Formula | C57H54O9 |
| Molecular Weight | 883.05 g/mol |
| Exact Mass | 882.38 |
| IUPAC Name | [(2S,3R)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] 4-hydroxycyclohexane-1-carboxylate |
| SMILES | O=C(O[C@@H]1Cc2c(OCc3ccccc3)cc(OCc3ccccc3)cc2O[C@H]1c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1)C1CCC(O)CC1 |
| InChI | InChI=1S/C57H54O9/c58-47-28-26-45(27-29-47)57(59)66-54-34-49-50(61-36-41-18-8-2-9-19-41)32-48(60-35-40-16-6-1-7-17-40)33-51(49)65-55(54)46-30-52(62-37-42-20-10-3-11-21-42)56(64-39-44-24-14-5-15-25-44)53(31-46)63-38-43-22-12-4-13-23-43/h1-25,30-33,45,47,54-55,58H,26-29,34-39H2/t45?,47?,54-,55+/m1/s1 |
| InChIKey | BWTGGDWSFCKTIB-FPPNLNCDSA-N |
| XLogP | 11.72 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.05 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |