C48H47NO7 — CID 163867461
1-[[(2R,3R)-2-[3,4-bis(phenylmethoxy)phenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl]oxy]ethyl propanimidate (PubChem CID 163867461) has the molecular formula C48H47NO7 and a molecular weight of 749.90 g/mol. Its IUPAC name is 1-[[(2R,3R)-2-[3,4-bis(phenylmethoxy)phenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl]oxy]ethyl propanimidate.
| Compound Name | 1-[[(2R,3R)-2-[3,4-bis(phenylmethoxy)phenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl]oxy]ethyl propanimidate |
|---|---|
| PubChem CID | 163867461 |
| Molecular Formula | C48H47NO7 |
| Molecular Weight | 749.90 g/mol |
| Exact Mass | 749.34 |
| IUPAC Name | 1-[[(2R,3R)-2-[3,4-bis(phenylmethoxy)phenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl]oxy]ethyl propanimidate |
| SMILES | [H]/N=C(\CC)OC(C)O[C@@H]1Cc2c(OCc3ccccc3)cc(OCc3ccccc3)cc2O[C@@H]1c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C48H47NO7/c1-3-47(49)55-34(2)54-46-29-41-43(52-32-37-20-12-6-13-21-37)27-40(50-30-35-16-8-4-9-17-35)28-44(41)56-48(46)39-24-25-42(51-31-36-18-10-5-11-19-36)45(26-39)53-33-38-22-14-7-15-23-38/h4-28,34,46,48-49H,3,29-33H2,1-2H3/b49-47+/t34?,46-,48-/m1/s1 |
| InChIKey | PHWCCPIUEZTCJG-ULTIKQKKSA-N |
| XLogP | 10.81 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.90 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|