C54H50O10 — CID 177496265
[(2R,3R,4S)-4-(2-hydroxyethoxy)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] acetate (PubChem CID 177496265) has the molecular formula C54H50O10 and a molecular weight of 858.98 g/mol. Its IUPAC name is [(2R,3R,4S)-4-(2-hydroxyethoxy)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] acetate.
| Compound Name | [(2R,3R,4S)-4-(2-hydroxyethoxy)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] acetate |
|---|---|
| PubChem CID | 177496265 |
| Molecular Formula | C54H50O10 |
| Molecular Weight | 858.98 g/mol |
| Exact Mass | 858.34 |
| IUPAC Name | [(2R,3R,4S)-4-(2-hydroxyethoxy)-5,7-bis(phenylmethoxy)-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](c2cc(OCc3ccccc3)c(OCc3ccccc3)c(OCc3ccccc3)c2)Oc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2[C@@H]1OCCO |
| InChI | InChI=1S/C54H50O10/c1-38(56)63-54-51(64-47-32-45(58-33-39-17-7-2-8-18-39)31-46(50(47)53(54)57-28-27-55)59-34-40-19-9-3-10-20-40)44-29-48(60-35-41-21-11-4-12-22-41)52(62-37-43-25-15-6-16-26-43)49(30-44)61-36-42-23-13-5-14-24-42/h2-26,29-32,51,53-55H,27-28,33-37H2,1H3/t51-,53+,54+/m1/s1 |
| InChIKey | STFUZVYVGHNBDJ-CVSPOACLSA-N |
| XLogP | 10.70 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.98 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |