C37H34O7 — CID 146270563
5-methoxy-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromene-3,7-diol (PubChem CID 146270563) has the molecular formula C37H34O7 and a molecular weight of 590.67 g/mol. Its IUPAC name is 5-methoxy-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromene-3,7-diol.
| Compound Name | 5-methoxy-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromene-3,7-diol |
|---|---|
| PubChem CID | 146270563 |
| Molecular Formula | C37H34O7 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 5-methoxy-2-[3,4,5-tris(phenylmethoxy)phenyl]-3,4-dihydro-2H-chromene-3,7-diol |
| SMILES | COc1cc(O)cc2c1CC(O)C(c1cc(OCc3ccccc3)c(OCc3ccccc3)c(OCc3ccccc3)c1)O2 |
| InChI | InChI=1S/C37H34O7/c1-40-32-19-29(38)20-33-30(32)21-31(39)36(44-33)28-17-34(41-22-25-11-5-2-6-12-25)37(43-24-27-15-9-4-10-16-27)35(18-28)42-23-26-13-7-3-8-14-26/h2-20,31,36,38-39H,21-24H2,1H3 |
| InChIKey | BJDGQNSYWHHGLC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |