C16H16O9S — CID 78119649
[3,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,4-dihydro-2H-chromen-5-yl] hydrogen sulfate (PubChem CID 78119649) has the molecular formula C16H16O9S and a molecular weight of 384.36 g/mol. Its IUPAC name is [3,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,4-dihydro-2H-chromen-5-yl] hydrogen sulfate.
| Compound Name | [3,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,4-dihydro-2H-chromen-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78119649 |
| Molecular Formula | C16H16O9S |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | [3,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,4-dihydro-2H-chromen-5-yl] hydrogen sulfate |
| SMILES | COc1cc(C2Oc3cc(O)cc(OS(=O)(=O)O)c3CC2O)ccc1O |
| InChI | InChI=1S/C16H16O9S/c1-23-15-4-8(2-3-11(15)18)16-12(19)7-10-13(24-16)5-9(17)6-14(10)25-26(20,21)22/h2-6,12,16-19H,7H2,1H3,(H,20,21,22) |
| InChIKey | ZFUHNDPCTCXKQO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|