C16H19NO9S — CID 71579212
azane;[(2R,3R)-3,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-5-yl] hydrogen sulfate (PubChem CID 71579212) has the molecular formula C16H19NO9S and a molecular weight of 401.39 g/mol. Its IUPAC name is azane;[(2R,3R)-3,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-5-yl] hydrogen sulfate.
| Compound Name | azane;[(2R,3R)-3,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71579212 |
| Molecular Formula | C16H19NO9S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | azane;[(2R,3R)-3,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-5-yl] hydrogen sulfate |
| SMILES | COc1ccc([C@H]2Oc3cc(O)cc(OS(=O)(=O)O)c3C[C@H]2O)cc1O.N |
| InChI | InChI=1S/C16H16O9S.H3N/c1-23-13-3-2-8(4-11(13)18)16-12(19)7-10-14(24-16)5-9(17)6-15(10)25-26(20,21)22;/h2-6,12,16-19H,7H2,1H3,(H,20,21,22);1H3/t12-,16-;/m1./s1 |
| InChIKey | DMHMXIAFPSXRQR-VQZRABBESA-N |
| XLogP | 1.49 |
| TPSA | 177.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|