C17H16O7 — CID 102421449
[2-hydroxy-4-[(2R,3S)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] acetate (PubChem CID 102421449) has the molecular formula C17H16O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is [2-hydroxy-4-[(2R,3S)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] acetate.
| Compound Name | [2-hydroxy-4-[(2R,3S)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 102421449 |
| Molecular Formula | C17H16O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [2-hydroxy-4-[(2R,3S)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@H]2Oc3cc(O)cc(O)c3C[C@@H]2O)cc1O |
| InChI | InChI=1S/C17H16O7/c1-8(18)23-15-3-2-9(4-13(15)21)17-14(22)7-11-12(20)5-10(19)6-16(11)24-17/h2-6,14,17,19-22H,7H2,1H3/t14-,17+/m0/s1 |
| InChIKey | RYEFJPMULGMZRN-WMLDXEAASA-N |
| XLogP | 1.77 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|