C29H24O15 — CID 146291079
(2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol;(3,4,5-trihydroxybenzoyl) 3,4,5-trihydroxybenzoate (PubChem CID 146291079) has the molecular formula C29H24O15 and a molecular weight of 612.50 g/mol. Its IUPAC name is (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol;(3,4,5-trihydroxybenzoyl) 3,4,5-trihydroxybenzoate.
| Compound Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol;(3,4,5-trihydroxybenzoyl) 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 146291079 |
| Molecular Formula | C29H24O15 |
| Molecular Weight | 612.50 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol;(3,4,5-trihydroxybenzoyl) 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1.Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C15H14O6.C14H10O9/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7;15-7-1-5(2-8(16)11(7)19)13(21)23-14(22)6-3-9(17)12(20)10(18)4-6/h1-5,13,15-20H,6H2;1-4,15-20H/t13-,15+;/m0./s1 |
| InChIKey | TVHUMHRMZUZLEO-NQQJLSKUSA-N |
| XLogP | 2.46 |
| TPSA | 275.13 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|