C22H19O11- — CID 54725816
4-carboxy-2,6-dihydroxyphenolate;(2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 54725816) has the molecular formula C22H19O11- and a molecular weight of 459.38 g/mol. Its IUPAC name is 4-carboxy-2,6-dihydroxyphenolate;(2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | 4-carboxy-2,6-dihydroxyphenolate;(2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 54725816 |
| Molecular Formula | C22H19O11- |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 4-carboxy-2,6-dihydroxyphenolate;(2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | O=C(O)c1cc(O)c([O-])c(O)c1.Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C15H14O6.C7H6O5/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7;8-4-1-3(7(11)12)2-5(9)6(4)10/h1-5,13,15-20H,6H2;1-2,8-10H,(H,11,12)/p-1/t13-,15+;/m0./s1 |
| InChIKey | RBDLEBJCWHJCOK-NQQJLSKUSA-M |
| XLogP | 1.42 |
| TPSA | 211.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|