C34H34O16 — CID 175541831
butanedioic acid;bis((2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol) (PubChem CID 175541831) has the molecular formula C34H34O16 and a molecular weight of 698.63 g/mol. Its IUPAC name is butanedioic acid;bis((2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol).
| Compound Name | butanedioic acid;bis((2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol) |
|---|---|
| PubChem CID | 175541831 |
| Molecular Formula | C34H34O16 |
| Molecular Weight | 698.63 g/mol |
| Exact Mass | 698.18 |
| IUPAC Name | butanedioic acid;bis((2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol) |
| SMILES | O=C(O)CCC(=O)O.Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2.Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/2C15H14O6.C4H6O4/c2*16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7;5-3(6)1-2-4(7)8/h2*1-5,13,15-20H,6H2;1-2H2,(H,5,6)(H,7,8)/t2*13-,15+;/m00./s1 |
| InChIKey | WPCHWAUYCPEALC-RKULYZFMSA-N |
| XLogP | 3.03 |
| TPSA | 295.36 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|