C19H18O10 — CID 24814100
2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]butanedioic acid (PubChem CID 24814100) has the molecular formula C19H18O10 and a molecular weight of 406.34 g/mol. Its IUPAC name is 2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]butanedioic acid.
| Compound Name | 2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]butanedioic acid |
|---|---|
| PubChem CID | 24814100 |
| Molecular Formula | C19H18O10 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]butanedioic acid |
| SMILES | O=C(O)CC(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C19H18O10/c20-9-4-12(22)10-6-15(28-16(19(26)27)7-17(24)25)18(29-14(10)5-9)8-1-2-11(21)13(23)3-8/h1-5,15-16,18,20-23H,6-7H2,(H,24,25)(H,26,27)/t15-,16?,18-/m1/s1 |
| InChIKey | NSNRQKWIGKNCIC-IFJNFQAOSA-N |
| XLogP | 1.50 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|