C23H29NO8 — CID 78131084
[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxymethyl N,N-di(propan-2-yl)carbamate (PubChem CID 78131084) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxymethyl N,N-di(propan-2-yl)carbamate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxymethyl N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 78131084 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxymethyl N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)OCOC1Cc2c(O)cc(O)cc2OC1c1ccc(O)c(O)c1)C(C)C |
| InChI | InChI=1S/C23H29NO8/c1-12(2)24(13(3)4)23(29)31-11-30-21-10-16-18(27)8-15(25)9-20(16)32-22(21)14-5-6-17(26)19(28)7-14/h5-9,12-13,21-22,25-28H,10-11H2,1-4H3 |
| InChIKey | ZYKRLDODEICJRI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|