C35H34O13 — CID 141421480
bis[(1R)-1-[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]ethyl] carbonate (PubChem CID 141421480) has the molecular formula C35H34O13 and a molecular weight of 662.64 g/mol. Its IUPAC name is bis[(1R)-1-[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]ethyl] carbonate.
| Compound Name | bis[(1R)-1-[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]ethyl] carbonate |
|---|---|
| PubChem CID | 141421480 |
| Molecular Formula | C35H34O13 |
| Molecular Weight | 662.64 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | bis[(1R)-1-[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]ethyl] carbonate |
| SMILES | C[C@@H](OC(=O)O[C@H](C)[C@H]1Cc2c(O)cc(O)cc2O[C@H]1c1ccc(O)c(O)c1)[C@H]1Cc2c(O)cc(O)cc2O[C@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C35H34O13/c1-15(21-13-23-27(40)9-19(36)11-31(23)47-33(21)17-3-5-25(38)29(42)7-17)45-35(44)46-16(2)22-14-24-28(41)10-20(37)12-32(24)48-34(22)18-4-6-26(39)30(43)8-18/h3-12,15-16,21-22,33-34,36-43H,13-14H2,1-2H3/t15-,16-,21-,22-,33+,34+/m1/s1 |
| InChIKey | FXGXCOOSJYJVAS-OCFWJMBUSA-N |
| XLogP | 5.55 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|