C19H18O10 — CID 86271617
[2-methoxycarbonyloxy-4-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] methyl carbonate (PubChem CID 86271617) has the molecular formula C19H18O10 and a molecular weight of 406.34 g/mol. Its IUPAC name is [2-methoxycarbonyloxy-4-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] methyl carbonate.
| Compound Name | [2-methoxycarbonyloxy-4-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 86271617 |
| Molecular Formula | C19H18O10 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [2-methoxycarbonyloxy-4-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)cc1OC(=O)OC |
| InChI | InChI=1S/C19H18O10/c1-25-18(23)28-14-4-3-9(5-16(14)29-19(24)26-2)17-13(22)8-11-12(21)6-10(20)7-15(11)27-17/h3-7,13,17,20-22H,8H2,1-2H3/t13-,17-/m1/s1 |
| InChIKey | UIPAEQGWCDQNOP-CXAGYDPISA-N |
| XLogP | 2.43 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|