C16H16O9S — CID 71579211
[2-methoxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate (PubChem CID 71579211) has the molecular formula C16H16O9S and a molecular weight of 384.36 g/mol. Its IUPAC name is [2-methoxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate.
| Compound Name | [2-methoxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 71579211 |
| Molecular Formula | C16H16O9S |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | [2-methoxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate |
| SMILES | COc1ccc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)cc1OS(=O)(=O)O |
| InChI | InChI=1S/C16H16O9S/c1-23-13-3-2-8(4-15(13)25-26(20,21)22)16-12(19)7-10-11(18)5-9(17)6-14(10)24-16/h2-6,12,16-19H,7H2,1H3,(H,20,21,22)/t12-,16-/m1/s1 |
| InChIKey | PCLCJMJFLFTHDU-MLGOLLRUSA-N |
| XLogP | 1.33 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|