C16H16O11S2 — CID 131834276
3,5,6-trihydroxy-2-(4-methoxy-3-sulfooxyphenyl)-3,4-dihydro-2H-chromene-7-sulfinic acid (PubChem CID 131834276) has the molecular formula C16H16O11S2 and a molecular weight of 448.43 g/mol. Its IUPAC name is 3,5,6-trihydroxy-2-(4-methoxy-3-sulfooxyphenyl)-3,4-dihydro-2H-chromene-7-sulfinic acid.
| Compound Name | 3,5,6-trihydroxy-2-(4-methoxy-3-sulfooxyphenyl)-3,4-dihydro-2H-chromene-7-sulfinic acid |
|---|---|
| PubChem CID | 131834276 |
| Molecular Formula | C16H16O11S2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 3,5,6-trihydroxy-2-(4-methoxy-3-sulfooxyphenyl)-3,4-dihydro-2H-chromene-7-sulfinic acid |
| SMILES | COc1ccc(C2Oc3cc(S(=O)O)c(O)c(O)c3CC2O)cc1OS(=O)(=O)O |
| InChI | InChI=1S/C16H16O11S2/c1-25-10-3-2-7(4-12(10)27-29(22,23)24)16-9(17)5-8-11(26-16)6-13(28(20)21)15(19)14(8)18/h2-4,6,9,16-19H,5H2,1H3,(H,20,21)(H,22,23,24) |
| InChIKey | DCRRXXMWVUQDOK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|