C16H16O10S — CID 76956539
[3-hydroxy-2-methoxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate (PubChem CID 76956539) has the molecular formula C16H16O10S and a molecular weight of 400.36 g/mol. Its IUPAC name is [3-hydroxy-2-methoxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate.
| Compound Name | [3-hydroxy-2-methoxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 76956539 |
| Molecular Formula | C16H16O10S |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | [3-hydroxy-2-methoxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate |
| SMILES | COc1c(O)cc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)cc1OS(=O)(=O)O |
| InChI | InChI=1S/C16H16O10S/c1-24-16-11(19)2-7(3-14(16)26-27(21,22)23)15-12(20)6-9-10(18)4-8(17)5-13(9)25-15/h2-5,12,15,17-20H,6H2,1H3,(H,21,22,23)/t12-,15-/m1/s1 |
| InChIKey | MXQPVXBIHUDTSP-IUODEOHRSA-N |
| XLogP | 1.03 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|