C15H14O8P+ — CID 102455034
hydroxy-[2-hydroxy-4-[(2R,3S)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenoxy]-oxophosphanium (PubChem CID 102455034) has the molecular formula C15H14O8P+ and a molecular weight of 353.24 g/mol. Its IUPAC name is hydroxy-[2-hydroxy-4-[(2R,3S)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenoxy]-oxophosphanium.
| Compound Name | hydroxy-[2-hydroxy-4-[(2R,3S)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenoxy]-oxophosphanium |
|---|---|
| PubChem CID | 102455034 |
| Molecular Formula | C15H14O8P+ |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | hydroxy-[2-hydroxy-4-[(2R,3S)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenoxy]-oxophosphanium |
| SMILES | O=[P+](O)Oc1ccc([C@H]2Oc3cc(O)cc(O)c3C[C@@H]2O)cc1O |
| InChI | InChI=1S/C15H13O8P/c16-8-4-10(17)9-6-12(19)15(22-14(9)5-8)7-1-2-13(11(18)3-7)23-24(20)21/h1-5,12,15,19H,6H2,(H3-,16,17,18,20,21)/p+1/t12-,15+/m0/s1 |
| InChIKey | XSOAYBMUQISFDW-SWLSCSKDSA-O |
| XLogP | 1.87 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|