C21H24O8 — CID 172694507
[1-[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]-2,2-dimethylpropyl] hydrogen carbonate (PubChem CID 172694507) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is [1-[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]-2,2-dimethylpropyl] hydrogen carbonate.
| Compound Name | [1-[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]-2,2-dimethylpropyl] hydrogen carbonate |
|---|---|
| PubChem CID | 172694507 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [1-[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]-2,2-dimethylpropyl] hydrogen carbonate |
| SMILES | CC(C)(C)C(OC(=O)O)[C@@H]1Cc2c(O)cc(O)cc2O[C@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H24O8/c1-21(2,3)19(29-20(26)27)13-9-12-15(24)7-11(22)8-17(12)28-18(13)10-4-5-14(23)16(25)6-10/h4-8,13,18-19,22-25H,9H2,1-3H3,(H,26,27)/t13-,18+,19?/m1/s1 |
| InChIKey | CDHAVHRMOFADHX-OJBAKJFDSA-N |
| XLogP | 3.91 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|