C18H18O8 — CID 118886889
[(3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] ethyl carbonate (PubChem CID 118886889) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is [(3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] ethyl carbonate.
| Compound Name | [(3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 118886889 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [(3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@@H]1Cc2c(O)cc(O)cc2OC1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H18O8/c1-2-24-18(23)26-16-8-11-13(21)6-10(19)7-15(11)25-17(16)9-3-4-12(20)14(22)5-9/h3-7,16-17,19-22H,2,8H2,1H3/t16-,17?/m1/s1 |
| InChIKey | HOUVBVRSDHQPDY-TZHYSIJRSA-N |
| XLogP | 2.73 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|