C16H14O8S — CID 123441304
5-(4-hydroxy-3-methoxyphenyl)-11,11-dioxo-6,10,12-trioxa-11λ6-thiatricyclo[7.3.1.02,7]trideca-1(13),2(7),8-trien-4-ol (PubChem CID 123441304) has the molecular formula C16H14O8S and a molecular weight of 366.35 g/mol. Its IUPAC name is 5-(4-hydroxy-3-methoxyphenyl)-11,11-dioxo-6,10,12-trioxa-11λ6-thiatricyclo[7.3.1.02,7]trideca-1(13),2(7),8-trien-4-ol.
| Compound Name | 5-(4-hydroxy-3-methoxyphenyl)-11,11-dioxo-6,10,12-trioxa-11λ6-thiatricyclo[7.3.1.02,7]trideca-1(13),2(7),8-trien-4-ol |
|---|---|
| PubChem CID | 123441304 |
| Molecular Formula | C16H14O8S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)-11,11-dioxo-6,10,12-trioxa-11λ6-thiatricyclo[7.3.1.02,7]trideca-1(13),2(7),8-trien-4-ol |
| SMILES | COc1cc(C2Oc3cc4cc(c3CC2O)OS(=O)(=O)O4)ccc1O |
| InChI | InChI=1S/C16H14O8S/c1-21-15-4-8(2-3-11(15)17)16-12(18)7-10-13(22-16)5-9-6-14(10)24-25(19,20)23-9/h2-6,12,16-18H,7H2,1H3 |
| InChIKey | KNGBWRVHPGHZOJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |