C24H22O6 — CID 162926206
(2R,3S)-2-(4-hydroxy-3-methoxyphenyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8,11-triol (PubChem CID 162926206) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is (2R,3S)-2-(4-hydroxy-3-methoxyphenyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8,11-triol.
| Compound Name | (2R,3S)-2-(4-hydroxy-3-methoxyphenyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8,11-triol |
|---|---|
| PubChem CID | 162926206 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (2R,3S)-2-(4-hydroxy-3-methoxyphenyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8,11-triol |
| SMILES | COc1cc([C@H]2Oc3cc(O)c4c(c3C[C@@H]2O)CCc2cc(O)ccc2-4)ccc1O |
| InChI | InChI=1S/C24H22O6/c1-29-22-9-13(3-7-18(22)26)24-20(28)10-17-16-5-2-12-8-14(25)4-6-15(12)23(16)19(27)11-21(17)30-24/h3-4,6-9,11,20,24-28H,2,5,10H2,1H3/t20-,24+/m0/s1 |
| InChIKey | USMHVDBYUBRDAM-GBXCKJPGSA-N |
| XLogP | 3.61 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |